C22H43IO4Si — CID 99771930
2-[[(E,6S,8S)-9-iodo-2,6-dimethyl-8-[(2R)-oxan-2-yl]oxynon-2-enoxy]methoxy]ethyl-trimethylsilane (PubChem CID 99771930) has the molecular formula C22H43IO4Si and a molecular weight of 526.57 g/mol. Its IUPAC name is 2-[[(E,6S,8S)-9-iodo-2,6-dimethyl-8-[(2R)-oxan-2-yl]oxynon-2-enoxy]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[(E,6S,8S)-9-iodo-2,6-dimethyl-8-[(2R)-oxan-2-yl]oxynon-2-enoxy]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 99771930 |
| Molecular Formula | C22H43IO4Si |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | 2-[[(E,6S,8S)-9-iodo-2,6-dimethyl-8-[(2R)-oxan-2-yl]oxynon-2-enoxy]methoxy]ethyl-trimethylsilane |
| SMILES | C/C(=C\CC[C@H](C)C[C@@H](CI)O[C@@H]1CCCCO1)COCOCC[Si](C)(C)C |
| InChI | InChI=1S/C22H43IO4Si/c1-19(15-21(16-23)27-22-11-6-7-12-26-22)9-8-10-20(2)17-25-18-24-13-14-28(3,4)5/h10,19,21-22H,6-9,11-18H2,1-5H3/b20-10+/t19-,21-,22+/m0/s1 |
| InChIKey | PBHPBLUBUKPSPA-AYEKUKRTSA-N |
| XLogP | 6.41 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|