C21H35IO3Si — CID 10863899
[(5E)-3-iodo-5-[5-(oxan-2-yloxy)pentylidene]-2,4,6,6a-tetrahydro-1H-pentalen-2-yl]oxy-trimethylsilane (PubChem CID 10863899) has the molecular formula C21H35IO3Si and a molecular weight of 490.50 g/mol. Its IUPAC name is [(5E)-3-iodo-5-[5-(oxan-2-yloxy)pentylidene]-2,4,6,6a-tetrahydro-1H-pentalen-2-yl]oxy-trimethylsilane.
| Compound Name | [(5E)-3-iodo-5-[5-(oxan-2-yloxy)pentylidene]-2,4,6,6a-tetrahydro-1H-pentalen-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10863899 |
| Molecular Formula | C21H35IO3Si |
| Molecular Weight | 490.50 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | [(5E)-3-iodo-5-[5-(oxan-2-yloxy)pentylidene]-2,4,6,6a-tetrahydro-1H-pentalen-2-yl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)OC1CC2C/C(=C\CCCCOC3CCCCO3)CC2=C1I |
| InChI | InChI=1S/C21H35IO3Si/c1-26(2,3)25-19-15-17-13-16(14-18(17)21(19)22)9-5-4-7-11-23-20-10-6-8-12-24-20/h9,17,19-20H,4-8,10-15H2,1-3H3/b16-9+ |
| InChIKey | GILFYCSSVRJKLD-CXUHLZMHSA-N |
| XLogP | 6.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.50 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|