C21H36O3Si — CID 10929295
trimethyl-[[(5E)-5-[5-(oxan-2-yloxy)pentylidene]-2,4,6,6a-tetrahydro-1H-pentalen-2-yl]oxy]silane (PubChem CID 10929295) has the molecular formula C21H36O3Si and a molecular weight of 364.60 g/mol. Its IUPAC name is trimethyl-[[(5E)-5-[5-(oxan-2-yloxy)pentylidene]-2,4,6,6a-tetrahydro-1H-pentalen-2-yl]oxy]silane.
| Compound Name | trimethyl-[[(5E)-5-[5-(oxan-2-yloxy)pentylidene]-2,4,6,6a-tetrahydro-1H-pentalen-2-yl]oxy]silane |
|---|---|
| PubChem CID | 10929295 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | trimethyl-[[(5E)-5-[5-(oxan-2-yloxy)pentylidene]-2,4,6,6a-tetrahydro-1H-pentalen-2-yl]oxy]silane |
| SMILES | C[Si](C)(C)OC1C=C2C/C(=C/CCCCOC3CCCCO3)CC2C1 |
| InChI | InChI=1S/C21H36O3Si/c1-25(2,3)24-20-15-18-13-17(14-19(18)16-20)9-5-4-7-11-22-21-10-6-8-12-23-21/h9,15,19-21H,4-8,10-14,16H2,1-3H3/b17-9- |
| InChIKey | BJTYCYBHMNAHEG-MFOYZWKCSA-N |
| XLogP | 5.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|