C29H52O3Si — CID 25111730
[(E,3R,4S,10R)-3,10-dimethyl-9-methylidene-12-(oxan-2-yloxy)dodec-5-en-1-yn-4-yl]oxy-tri(propan-2-yl)silane (PubChem CID 25111730) has the molecular formula C29H52O3Si and a molecular weight of 476.82 g/mol. Its IUPAC name is [(E,3R,4S,10R)-3,10-dimethyl-9-methylidene-12-(oxan-2-yloxy)dodec-5-en-1-yn-4-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(E,3R,4S,10R)-3,10-dimethyl-9-methylidene-12-(oxan-2-yloxy)dodec-5-en-1-yn-4-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 25111730 |
| Molecular Formula | C29H52O3Si |
| Molecular Weight | 476.82 g/mol |
| Exact Mass | 476.37 |
| IUPAC Name | [(E,3R,4S,10R)-3,10-dimethyl-9-methylidene-12-(oxan-2-yloxy)dodec-5-en-1-yn-4-yl]oxy-tri(propan-2-yl)silane |
| SMILES | C#C[C@@H](C)[C@H](/C=C/CCC(=C)[C@H](C)CCOC1CCCCO1)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H52O3Si/c1-11-25(8)28(32-33(22(2)3,23(4)5)24(6)7)17-13-12-16-26(9)27(10)19-21-31-29-18-14-15-20-30-29/h1,13,17,22-25,27-29H,9,12,14-16,18-21H2,2-8,10H3/b17-13+/t25-,27-,28+,29?/m1/s1 |
| InChIKey | CTWSIEWBODZIBF-JTDMLGEYSA-N |
| XLogP | 8.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.82 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|