C32H60O3Si2 — CID 25111729
[(E,3R,4S,10R)-3,10-dimethyl-9-methylidene-12-(oxan-2-yloxy)-1-trimethylsilyldodec-5-en-1-yn-4-yl]oxy-tri(propan-2-yl)silane (PubChem CID 25111729) has the molecular formula C32H60O3Si2 and a molecular weight of 549.00 g/mol. Its IUPAC name is [(E,3R,4S,10R)-3,10-dimethyl-9-methylidene-12-(oxan-2-yloxy)-1-trimethylsilyldodec-5-en-1-yn-4-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(E,3R,4S,10R)-3,10-dimethyl-9-methylidene-12-(oxan-2-yloxy)-1-trimethylsilyldodec-5-en-1-yn-4-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 25111729 |
| Molecular Formula | C32H60O3Si2 |
| Molecular Weight | 549.00 g/mol |
| Exact Mass | 548.41 |
| IUPAC Name | [(E,3R,4S,10R)-3,10-dimethyl-9-methylidene-12-(oxan-2-yloxy)-1-trimethylsilyldodec-5-en-1-yn-4-yl]oxy-tri(propan-2-yl)silane |
| SMILES | C=C(CC/C=C/[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)C#C[Si](C)(C)C)[C@H](C)CCOC1CCCCO1 |
| InChI | InChI=1S/C32H60O3Si2/c1-25(2)37(26(3)4,27(5)6)35-31(30(9)21-24-36(10,11)12)18-14-13-17-28(7)29(8)20-23-34-32-19-15-16-22-33-32/h14,18,25-27,29-32H,7,13,15-17,19-20,22-23H2,1-6,8-12H3/b18-14+/t29-,30-,31+,32?/m1/s1 |
| InChIKey | BZGVYAQSYNEVQV-LUSYVKAYSA-N |
| XLogP | 9.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.00 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|