C24H40O3Si2 — CID 11070080
tert-butyl-[[5-(methoxymethoxy)-5-[(Z)-6-trimethylsilylhex-3-en-1,5-diynyl]cyclohexen-1-yl]methoxy]-dimethylsilane (PubChem CID 11070080) has the molecular formula C24H40O3Si2 and a molecular weight of 432.75 g/mol. Its IUPAC name is tert-butyl-[[5-(methoxymethoxy)-5-[(Z)-6-trimethylsilylhex-3-en-1,5-diynyl]cyclohexen-1-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[5-(methoxymethoxy)-5-[(Z)-6-trimethylsilylhex-3-en-1,5-diynyl]cyclohexen-1-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11070080 |
| Molecular Formula | C24H40O3Si2 |
| Molecular Weight | 432.75 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | tert-butyl-[[5-(methoxymethoxy)-5-[(Z)-6-trimethylsilylhex-3-en-1,5-diynyl]cyclohexen-1-yl]methoxy]-dimethylsilane |
| SMILES | COCOC1(C#C/C=C\C#C[Si](C)(C)C)CCC=C(CO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C24H40O3Si2/c1-23(2,3)29(8,9)27-20-22-15-14-17-24(19-22,26-21-25-4)16-12-10-11-13-18-28(5,6)7/h10-11,15H,14,17,19-21H2,1-9H3/b11-10- |
| InChIKey | INAGCDGIPWJPAW-KHPPLWFESA-N |
| XLogP | 5.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.75 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|