C18H24O3Si — CID 11120669
[(2R,5Z,9S)-9-(methoxymethoxy)-2-bicyclo[7.3.1]trideca-1(12),5-dien-3,7-diynyl]oxy-trimethylsilane (PubChem CID 11120669) has the molecular formula C18H24O3Si and a molecular weight of 316.47 g/mol. Its IUPAC name is [(2R,5Z,9S)-9-(methoxymethoxy)-2-bicyclo[7.3.1]trideca-1(12),5-dien-3,7-diynyl]oxy-trimethylsilane.
| Compound Name | [(2R,5Z,9S)-9-(methoxymethoxy)-2-bicyclo[7.3.1]trideca-1(12),5-dien-3,7-diynyl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 11120669 |
| Molecular Formula | C18H24O3Si |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | [(2R,5Z,9S)-9-(methoxymethoxy)-2-bicyclo[7.3.1]trideca-1(12),5-dien-3,7-diynyl]oxy-trimethylsilane |
| SMILES | COCO[C@@]12C#C/C=C\C#C[C@H](O[Si](C)(C)C)C(=CCC1)C2 |
| InChI | InChI=1S/C18H24O3Si/c1-19-15-20-18-12-8-6-5-7-11-17(21-22(2,3)4)16(14-18)10-9-13-18/h5-6,10,17H,9,13-15H2,1-4H3/b6-5-/t17-,18-/m0/s1 |
| InChIKey | KENOVSXROUMSHA-SLXDBMQSSA-N |
| XLogP | 3.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|