C21H31IO3Si — CID 11049202
tert-butyl-[[5-[(Z)-6-iodohex-3-en-1,5-diynyl]-5-(methoxymethoxy)cyclohexen-1-yl]methoxy]-dimethylsilane (PubChem CID 11049202) has the molecular formula C21H31IO3Si and a molecular weight of 486.47 g/mol. Its IUPAC name is tert-butyl-[[5-[(Z)-6-iodohex-3-en-1,5-diynyl]-5-(methoxymethoxy)cyclohexen-1-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[5-[(Z)-6-iodohex-3-en-1,5-diynyl]-5-(methoxymethoxy)cyclohexen-1-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11049202 |
| Molecular Formula | C21H31IO3Si |
| Molecular Weight | 486.47 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | tert-butyl-[[5-[(Z)-6-iodohex-3-en-1,5-diynyl]-5-(methoxymethoxy)cyclohexen-1-yl]methoxy]-dimethylsilane |
| SMILES | COCOC1(C#C/C=C\C#CI)CCC=C(CO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C21H31IO3Si/c1-20(2,3)26(5,6)25-17-19-12-11-14-21(16-19,24-18-23-4)13-9-7-8-10-15-22/h7-8,12H,11,14,16-18H2,1-6H3/b8-7- |
| InChIKey | MATJYQPJVYVVGW-FPLPWBNLSA-N |
| XLogP | 5.43 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.47 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|