C35H64O4Si2 — CID 11006551
tert-butyl-dimethyl-[(E)-1-[(5E)-5-[5-(oxan-2-yloxy)pentylidene]-2-trimethylsilyloxy-3,3a,4,6-tetrahydro-2H-pentalen-1-yl]oct-1-en-3-yl]oxysilane (PubChem CID 11006551) has the molecular formula C35H64O4Si2 and a molecular weight of 605.07 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E)-1-[(5E)-5-[5-(oxan-2-yloxy)pentylidene]-2-trimethylsilyloxy-3,3a,4,6-tetrahydro-2H-pentalen-1-yl]oct-1-en-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(E)-1-[(5E)-5-[5-(oxan-2-yloxy)pentylidene]-2-trimethylsilyloxy-3,3a,4,6-tetrahydro-2H-pentalen-1-yl]oct-1-en-3-yl]oxysilane |
|---|---|
| PubChem CID | 11006551 |
| Molecular Formula | C35H64O4Si2 |
| Molecular Weight | 605.07 g/mol |
| Exact Mass | 604.43 |
| IUPAC Name | tert-butyl-dimethyl-[(E)-1-[(5E)-5-[5-(oxan-2-yloxy)pentylidene]-2-trimethylsilyloxy-3,3a,4,6-tetrahydro-2H-pentalen-1-yl]oct-1-en-3-yl]oxysilane |
| SMILES | CCCCCC(/C=C/C1=C2C/C(=C/CCCCOC3CCCCO3)CC2CC1O[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H64O4Si2/c1-10-11-13-19-30(38-41(8,9)35(2,3)4)21-22-31-32-26-28(25-29(32)27-33(31)39-40(5,6)7)18-14-12-16-23-36-34-20-15-17-24-37-34/h18,21-22,29-30,33-34H,10-17,19-20,23-27H2,1-9H3/b22-21+,28-18+ |
| InChIKey | OYBAFGVZFAZLAB-PGBAKOLDSA-N |
| XLogP | 10.48 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.07 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|