C32H54O4Si — CID 10995036
(5E)-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-[5-(oxan-2-yloxy)pentylidene]-1,4,6,6a-tetrahydropentalen-2-one (PubChem CID 10995036) has the molecular formula C32H54O4Si and a molecular weight of 530.87 g/mol. Its IUPAC name is (5E)-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-[5-(oxan-2-yloxy)pentylidene]-1,4,6,6a-tetrahydropentalen-2-one.
| Compound Name | (5E)-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-[5-(oxan-2-yloxy)pentylidene]-1,4,6,6a-tetrahydropentalen-2-one |
|---|---|
| PubChem CID | 10995036 |
| Molecular Formula | C32H54O4Si |
| Molecular Weight | 530.87 g/mol |
| Exact Mass | 530.38 |
| IUPAC Name | (5E)-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-[5-(oxan-2-yloxy)pentylidene]-1,4,6,6a-tetrahydropentalen-2-one |
| SMILES | CCCCCC(/C=C/C1=C2C/C(=C/CCCCOC3CCCCO3)CC2CC1=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H54O4Si/c1-7-8-10-16-27(36-37(5,6)32(2,3)4)18-19-28-29-23-25(22-26(29)24-30(28)33)15-11-9-13-20-34-31-17-12-14-21-35-31/h15,18-19,26-27,31H,7-14,16-17,20-24H2,1-6H3/b19-18+,25-15+ |
| InChIKey | LOAUYYHTXGDTMO-GWEXMFDOSA-N |
| XLogP | 8.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.87 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|