C21H35BrO3SiZn — CID 10929294
bromozinc(1+);trimethyl-[[(5E)-5-[5-(oxan-2-yloxy)pentylidene]-1,2,3,3a,4,6-hexahydropentalen-1-id-2-yl]oxy]silane (PubChem CID 10929294) has the molecular formula C21H35BrO3SiZn and a molecular weight of 508.89 g/mol. Its IUPAC name is bromozinc(1+);trimethyl-[[(5E)-5-[5-(oxan-2-yloxy)pentylidene]-1,2,3,3a,4,6-hexahydropentalen-1-id-2-yl]oxy]silane.
| Compound Name | bromozinc(1+);trimethyl-[[(5E)-5-[5-(oxan-2-yloxy)pentylidene]-1,2,3,3a,4,6-hexahydropentalen-1-id-2-yl]oxy]silane |
|---|---|
| PubChem CID | 10929294 |
| Molecular Formula | C21H35BrO3SiZn |
| Molecular Weight | 508.89 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | bromozinc(1+);trimethyl-[[(5E)-5-[5-(oxan-2-yloxy)pentylidene]-1,2,3,3a,4,6-hexahydropentalen-1-id-2-yl]oxy]silane |
| SMILES | C[Si](C)(C)OC1[C-]=C2C/C(=C/CCCCOC3CCCCO3)CC2C1.[Zn+]Br |
| InChI | InChI=1S/C21H35O3Si.BrH.Zn/c1-25(2,3)24-20-15-18-13-17(14-19(18)16-20)9-5-4-7-11-22-21-10-6-8-12-23-21;;/h9,18,20-21H,4-8,10-15H2,1-3H3;1H;/q-1;;+2/p-1/b17-9+;; |
| InChIKey | GCSLHWJKECZVOE-CECDQNOMSA-M |
| XLogP | 6.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.89 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|