C30H58O4Si2 — CID 24756315
tert-butyl-[(Z,4S,5R,6R,7R)-5,7-dimethyl-11-(oxan-2-yloxy)-4-triethylsilyloxyundec-9-en-1-yn-6-yl]oxy-dimethylsilane (PubChem CID 24756315) has the molecular formula C30H58O4Si2 and a molecular weight of 538.96 g/mol. Its IUPAC name is tert-butyl-[(Z,4S,5R,6R,7R)-5,7-dimethyl-11-(oxan-2-yloxy)-4-triethylsilyloxyundec-9-en-1-yn-6-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(Z,4S,5R,6R,7R)-5,7-dimethyl-11-(oxan-2-yloxy)-4-triethylsilyloxyundec-9-en-1-yn-6-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 24756315 |
| Molecular Formula | C30H58O4Si2 |
| Molecular Weight | 538.96 g/mol |
| Exact Mass | 538.39 |
| IUPAC Name | tert-butyl-[(Z,4S,5R,6R,7R)-5,7-dimethyl-11-(oxan-2-yloxy)-4-triethylsilyloxyundec-9-en-1-yn-6-yl]oxy-dimethylsilane |
| SMILES | C#CC[C@H](O[Si](CC)(CC)CC)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C/C=C\COC1CCCCO1 |
| InChI | InChI=1S/C30H58O4Si2/c1-12-20-27(33-36(13-2,14-3)15-4)26(6)29(34-35(10,11)30(7,8)9)25(5)21-16-18-23-31-28-22-17-19-24-32-28/h1,16,18,25-29H,13-15,17,19-24H2,2-11H3/b18-16-/t25-,26-,27+,28?,29-/m1/s1 |
| InChIKey | CFGZJQAYPRHZCO-UGNZTZPJSA-N |
| XLogP | 8.55 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.96 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|