C21H36O3Si — CID 102171915
tert-butyl-dimethyl-[(E)-3-[(1R,2S)-2-[1-(oxan-2-yloxy)prop-2-ynyl]cyclopropyl]but-2-enoxy]silane (PubChem CID 102171915) has the molecular formula C21H36O3Si and a molecular weight of 364.60 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E)-3-[(1R,2S)-2-[1-(oxan-2-yloxy)prop-2-ynyl]cyclopropyl]but-2-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(E)-3-[(1R,2S)-2-[1-(oxan-2-yloxy)prop-2-ynyl]cyclopropyl]but-2-enoxy]silane |
|---|---|
| PubChem CID | 102171915 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | tert-butyl-dimethyl-[(E)-3-[(1R,2S)-2-[1-(oxan-2-yloxy)prop-2-ynyl]cyclopropyl]but-2-enoxy]silane |
| SMILES | C#CC(OC1CCCCO1)[C@H]1C[C@H]1/C(C)=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36O3Si/c1-8-19(24-20-11-9-10-13-22-20)18-15-17(18)16(2)12-14-23-25(6,7)21(3,4)5/h1,12,17-20H,9-11,13-15H2,2-7H3/b16-12+/t17-,18-,19?,20?/m0/s1 |
| InChIKey | ASLFQOPNRABCEW-VAPXDFDTSA-N |
| XLogP | 5.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|