C22H38O3Si — CID 102224770
tert-butyl-[(2S)-1-[(1R,2S,6S)-2-(methoxymethoxy)-3-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]but-3-yn-2-yl]oxy-dimethylsilane (PubChem CID 102224770) has the molecular formula C22H38O3Si and a molecular weight of 378.63 g/mol. Its IUPAC name is tert-butyl-[(2S)-1-[(1R,2S,6S)-2-(methoxymethoxy)-3-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]but-3-yn-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S)-1-[(1R,2S,6S)-2-(methoxymethoxy)-3-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]but-3-yn-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 102224770 |
| Molecular Formula | C22H38O3Si |
| Molecular Weight | 378.63 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | tert-butyl-[(2S)-1-[(1R,2S,6S)-2-(methoxymethoxy)-3-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]but-3-yn-2-yl]oxy-dimethylsilane |
| SMILES | C#C[C@H](C[C@@H]1[C@@H](C(=C)C)CC=C(C)[C@H]1OCOC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H38O3Si/c1-11-18(25-26(9,10)22(5,6)7)14-20-19(16(2)3)13-12-17(4)21(20)24-15-23-8/h1,12,18-21H,2,13-15H2,3-10H3/t18-,19-,20-,21-/m1/s1 |
| InChIKey | QGSNZAMLFYSZHH-XRXFAXGQSA-N |
| XLogP | 5.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.63 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|