C24H42O4Si — CID 11596992
6-[tert-butyl(dimethyl)silyl]oxy-1-[(1S,2R,6R)-2-(methoxymethoxy)-3-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]hex-3-yn-2-ol (PubChem CID 11596992) has the molecular formula C24H42O4Si and a molecular weight of 422.68 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxy-1-[(1S,2R,6R)-2-(methoxymethoxy)-3-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]hex-3-yn-2-ol.
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxy-1-[(1S,2R,6R)-2-(methoxymethoxy)-3-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]hex-3-yn-2-ol |
|---|---|
| PubChem CID | 11596992 |
| Molecular Formula | C24H42O4Si |
| Molecular Weight | 422.68 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxy-1-[(1S,2R,6R)-2-(methoxymethoxy)-3-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]hex-3-yn-2-ol |
| SMILES | C=C(C)[C@@H]1CC=C(C)[C@H](OCOC)[C@H]1CC(O)C#CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H42O4Si/c1-18(2)21-14-13-19(3)23(27-17-26-7)22(21)16-20(25)12-10-11-15-28-29(8,9)24(4,5)6/h13,20-23,25H,1,11,14-17H2,2-9H3/t20?,21-,22-,23-/m0/s1 |
| InChIKey | LXZIHVXBTXHPEM-KVROEHFOSA-N |
| XLogP | 5.30 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.68 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|