C26H50O5Si — CID 90700206
(2S,5R,6S,7S)-8-methoxy-7-(methoxymethoxy)-2,4,6-trimethyl-5-triethylsilyloxytetradeca-3,9,13-trien-1-ol (PubChem CID 90700206) has the molecular formula C26H50O5Si and a molecular weight of 470.77 g/mol. Its IUPAC name is (2S,5R,6S,7S)-8-methoxy-7-(methoxymethoxy)-2,4,6-trimethyl-5-triethylsilyloxytetradeca-3,9,13-trien-1-ol.
| Compound Name | (2S,5R,6S,7S)-8-methoxy-7-(methoxymethoxy)-2,4,6-trimethyl-5-triethylsilyloxytetradeca-3,9,13-trien-1-ol |
|---|---|
| PubChem CID | 90700206 |
| Molecular Formula | C26H50O5Si |
| Molecular Weight | 470.77 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | (2S,5R,6S,7S)-8-methoxy-7-(methoxymethoxy)-2,4,6-trimethyl-5-triethylsilyloxytetradeca-3,9,13-trien-1-ol |
| SMILES | C=CCCC=CC(OC)[C@@H](OCOC)[C@H](C)[C@@H](O[Si](CC)(CC)CC)C(C)=C[C@H](C)CO |
| InChI | InChI=1S/C26H50O5Si/c1-10-14-15-16-17-24(29-9)26(30-20-28-8)23(7)25(22(6)18-21(5)19-27)31-32(11-2,12-3)13-4/h10,16-18,21,23-27H,1,11-15,19-20H2,2-9H3/t21-,23+,24?,25-,26-/m0/s1 |
| InChIKey | MHFSLIFDDPXZEM-FUVJGYMZSA-N |
| XLogP | 6.11 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.77 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|