C32H62O7Si2 — CID 164668910
(1R,5R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-1-[(1S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl]-5,6-bis(methoxymethoxy)-4,4-dimethylhept-2-yn-1-ol (PubChem CID 164668910) has the molecular formula C32H62O7Si2 and a molecular weight of 615.01 g/mol. Its IUPAC name is (1R,5R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-1-[(1S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl]-5,6-bis(methoxymethoxy)-4,4-dimethylhept-2-yn-1-ol.
| Compound Name | (1R,5R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-1-[(1S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl]-5,6-bis(methoxymethoxy)-4,4-dimethylhept-2-yn-1-ol |
|---|---|
| PubChem CID | 164668910 |
| Molecular Formula | C32H62O7Si2 |
| Molecular Weight | 615.01 g/mol |
| Exact Mass | 614.40 |
| IUPAC Name | (1R,5R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-1-[(1S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl]-5,6-bis(methoxymethoxy)-4,4-dimethylhept-2-yn-1-ol |
| SMILES | COCO[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](OCOC)C(C)(C)C#C[C@H](O)[C@H]1CCCC=C1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H62O7Si2/c1-30(2,3)40(11,12)38-21-25-17-15-16-18-26(25)27(33)19-20-32(7,8)29(37-24-35-10)28(36-23-34-9)22-39-41(13,14)31(4,5)6/h17,26-29,33H,15-16,18,21-24H2,1-14H3/t26-,27-,28+,29-/m0/s1 |
| InChIKey | KJSYWKSQRKMFDS-FKWFRFQNSA-N |
| XLogP | 7.13 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.01 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|