C20H36O5Si — CID 134866331
4-[tert-butyl(dimethyl)silyl]oxy-1-[(1S,4S,6R)-6-(methoxymethoxy)-4-(methoxymethyl)cyclohex-2-en-1-yl]but-2-yn-1-ol (PubChem CID 134866331) has the molecular formula C20H36O5Si and a molecular weight of 384.59 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-1-[(1S,4S,6R)-6-(methoxymethoxy)-4-(methoxymethyl)cyclohex-2-en-1-yl]but-2-yn-1-ol.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-1-[(1S,4S,6R)-6-(methoxymethoxy)-4-(methoxymethyl)cyclohex-2-en-1-yl]but-2-yn-1-ol |
|---|---|
| PubChem CID | 134866331 |
| Molecular Formula | C20H36O5Si |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-1-[(1S,4S,6R)-6-(methoxymethoxy)-4-(methoxymethyl)cyclohex-2-en-1-yl]but-2-yn-1-ol |
| SMILES | COCO[C@@H]1C[C@H](COC)C=C[C@H]1C(O)C#CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H36O5Si/c1-20(2,3)26(6,7)25-12-8-9-18(21)17-11-10-16(14-22-4)13-19(17)24-15-23-5/h10-11,16-19,21H,12-15H2,1-7H3/t16-,17+,18?,19-/m1/s1 |
| InChIKey | BUOQHLIDBDCOFX-ZZJWQFMZSA-N |
| XLogP | 3.20 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|