C21H42O4Si — CID 11406548
(4S,6R,7S,8S)-9-(1,3-dioxan-2-yl)-6,8-dimethyl-7-triethylsilyloxynon-1-en-4-ol (PubChem CID 11406548) has the molecular formula C21H42O4Si and a molecular weight of 386.65 g/mol. Its IUPAC name is (4S,6R,7S,8S)-9-(1,3-dioxan-2-yl)-6,8-dimethyl-7-triethylsilyloxynon-1-en-4-ol.
| Compound Name | (4S,6R,7S,8S)-9-(1,3-dioxan-2-yl)-6,8-dimethyl-7-triethylsilyloxynon-1-en-4-ol |
|---|---|
| PubChem CID | 11406548 |
| Molecular Formula | C21H42O4Si |
| Molecular Weight | 386.65 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | (4S,6R,7S,8S)-9-(1,3-dioxan-2-yl)-6,8-dimethyl-7-triethylsilyloxynon-1-en-4-ol |
| SMILES | C=CC[C@H](O)C[C@@H](C)[C@H](O[Si](CC)(CC)CC)[C@@H](C)CC1OCCCO1 |
| InChI | InChI=1S/C21H42O4Si/c1-7-12-19(22)15-17(5)21(25-26(8-2,9-3)10-4)18(6)16-20-23-13-11-14-24-20/h7,17-22H,1,8-16H2,2-6H3/t17-,18+,19+,21+/m1/s1 |
| InChIKey | TZAHEFTVYGLADB-JKBKZWBZSA-N |
| XLogP | 5.13 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.65 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|