C27H48O4Si — CID 16732039
(2R)-1-[(1S,2R,6R)-2-(methoxymethoxy)-4-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]-6-tri(propan-2-yl)silyloxyhex-3-yn-2-ol (PubChem CID 16732039) has the molecular formula C27H48O4Si and a molecular weight of 464.76 g/mol. Its IUPAC name is (2R)-1-[(1S,2R,6R)-2-(methoxymethoxy)-4-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]-6-tri(propan-2-yl)silyloxyhex-3-yn-2-ol.
| Compound Name | (2R)-1-[(1S,2R,6R)-2-(methoxymethoxy)-4-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]-6-tri(propan-2-yl)silyloxyhex-3-yn-2-ol |
|---|---|
| PubChem CID | 16732039 |
| Molecular Formula | C27H48O4Si |
| Molecular Weight | 464.76 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | (2R)-1-[(1S,2R,6R)-2-(methoxymethoxy)-4-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]-6-tri(propan-2-yl)silyloxyhex-3-yn-2-ol |
| SMILES | C=C(C)[C@@H]1CC(C)=C[C@H](OCOC)[C@H]1C[C@@H](O)C#CCCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H48O4Si/c1-19(2)25-15-23(9)16-27(30-18-29-10)26(25)17-24(28)13-11-12-14-31-32(20(3)4,21(5)6)22(7)8/h16,20-22,24-28H,1,12,14-15,17-18H2,2-10H3/t24-,25-,26-,27-/m0/s1 |
| InChIKey | ZFDFHCWGAPUZID-FWEHEUNISA-N |
| XLogP | 6.47 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.76 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|