C25H50O5Si — CID 11059560
(2E,4R,5S,6R,7R,8S,10E)-7-[tert-butyl(dimethyl)silyl]oxy-12-(methoxymethoxy)-2,4,6,8,10-pentamethyldodeca-2,10-diene-1,5-diol (PubChem CID 11059560) has the molecular formula C25H50O5Si and a molecular weight of 458.76 g/mol. Its IUPAC name is (2E,4R,5S,6R,7R,8S,10E)-7-[tert-butyl(dimethyl)silyl]oxy-12-(methoxymethoxy)-2,4,6,8,10-pentamethyldodeca-2,10-diene-1,5-diol.
| Compound Name | (2E,4R,5S,6R,7R,8S,10E)-7-[tert-butyl(dimethyl)silyl]oxy-12-(methoxymethoxy)-2,4,6,8,10-pentamethyldodeca-2,10-diene-1,5-diol |
|---|---|
| PubChem CID | 11059560 |
| Molecular Formula | C25H50O5Si |
| Molecular Weight | 458.76 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | (2E,4R,5S,6R,7R,8S,10E)-7-[tert-butyl(dimethyl)silyl]oxy-12-(methoxymethoxy)-2,4,6,8,10-pentamethyldodeca-2,10-diene-1,5-diol |
| SMILES | COCOC/C=C(\C)C[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](O)[C@H](C)/C=C(\C)CO |
| InChI | InChI=1S/C25H50O5Si/c1-18(12-13-29-17-28-9)14-21(4)24(30-31(10,11)25(6,7)8)22(5)23(27)20(3)15-19(2)16-26/h12,15,20-24,26-27H,13-14,16-17H2,1-11H3/b18-12+,19-15+/t20-,21+,22-,23+,24-/m1/s1 |
| InChIKey | OSICTEUMTOFNGK-SOUQDWPCSA-N |
| XLogP | 5.54 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.76 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|