C28H50O4Si — CID 11554753
(2R)-1-[(1S,2R,6R)-2-(methoxymethoxy)-3-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]-7-tri(propan-2-yl)silyloxyhept-3-yn-2-ol (PubChem CID 11554753) has the molecular formula C28H50O4Si and a molecular weight of 478.79 g/mol. Its IUPAC name is (2R)-1-[(1S,2R,6R)-2-(methoxymethoxy)-3-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]-7-tri(propan-2-yl)silyloxyhept-3-yn-2-ol.
| Compound Name | (2R)-1-[(1S,2R,6R)-2-(methoxymethoxy)-3-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]-7-tri(propan-2-yl)silyloxyhept-3-yn-2-ol |
|---|---|
| PubChem CID | 11554753 |
| Molecular Formula | C28H50O4Si |
| Molecular Weight | 478.79 g/mol |
| Exact Mass | 478.35 |
| IUPAC Name | (2R)-1-[(1S,2R,6R)-2-(methoxymethoxy)-3-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]-7-tri(propan-2-yl)silyloxyhept-3-yn-2-ol |
| SMILES | C=C(C)[C@@H]1CC=C(C)[C@H](OCOC)[C@H]1C[C@@H](O)C#CCCCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H50O4Si/c1-20(2)26-16-15-24(9)28(31-19-30-10)27(26)18-25(29)14-12-11-13-17-32-33(21(3)4,22(5)6)23(7)8/h15,21-23,25-29H,1,11,13,16-19H2,2-10H3/t25-,26-,27-,28-/m0/s1 |
| InChIKey | DJPZYJLDLUPMLV-LJWNLINESA-N |
| XLogP | 6.86 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.79 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|