C30H56O5Si — CID 139252214
(2E,4R,5R,7E,9E,13S,14S)-13-(methoxymethoxy)-2,4,7-trimethyl-14-tri(propan-2-yl)silyloxyhexadeca-2,7,9,15-tetraene-1,5-diol (PubChem CID 139252214) has the molecular formula C30H56O5Si and a molecular weight of 524.86 g/mol. Its IUPAC name is (2E,4R,5R,7E,9E,13S,14S)-13-(methoxymethoxy)-2,4,7-trimethyl-14-tri(propan-2-yl)silyloxyhexadeca-2,7,9,15-tetraene-1,5-diol.
| Compound Name | (2E,4R,5R,7E,9E,13S,14S)-13-(methoxymethoxy)-2,4,7-trimethyl-14-tri(propan-2-yl)silyloxyhexadeca-2,7,9,15-tetraene-1,5-diol |
|---|---|
| PubChem CID | 139252214 |
| Molecular Formula | C30H56O5Si |
| Molecular Weight | 524.86 g/mol |
| Exact Mass | 524.39 |
| IUPAC Name | (2E,4R,5R,7E,9E,13S,14S)-13-(methoxymethoxy)-2,4,7-trimethyl-14-tri(propan-2-yl)silyloxyhexadeca-2,7,9,15-tetraene-1,5-diol |
| SMILES | C=CC(O[Si](C(C)C)(C(C)C)C(C)C)[C@H](CC/C=C/C=C(\C)C[C@@H](O)[C@H](C)/C=C(\C)CO)OCOC |
| InChI | InChI=1S/C30H56O5Si/c1-12-29(35-36(22(2)3,23(4)5)24(6)7)30(34-21-33-11)17-15-13-14-16-25(8)19-28(32)27(10)18-26(9)20-31/h12-14,16,18,22-24,27-32H,1,15,17,19-21H2,2-11H3/b14-13+,25-16+,26-18+/t27-,28-,29?,30+/m1/s1 |
| InChIKey | RMNKVQCTTDNCOQ-NGDOXTLASA-N |
| XLogP | 7.33 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.86 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|