C26H47IO4Si — CID 10929915
2-[[(1E,3R,4S,5E,10R)-1-iodo-3,10-dimethyl-9-methylidene-12-(oxan-2-yloxy)dodeca-1,5-dien-4-yl]oxymethoxy]ethyl-trimethylsilane (PubChem CID 10929915) has the molecular formula C26H47IO4Si and a molecular weight of 578.65 g/mol. Its IUPAC name is 2-[[(1E,3R,4S,5E,10R)-1-iodo-3,10-dimethyl-9-methylidene-12-(oxan-2-yloxy)dodeca-1,5-dien-4-yl]oxymethoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[(1E,3R,4S,5E,10R)-1-iodo-3,10-dimethyl-9-methylidene-12-(oxan-2-yloxy)dodeca-1,5-dien-4-yl]oxymethoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 10929915 |
| Molecular Formula | C26H47IO4Si |
| Molecular Weight | 578.65 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | 2-[[(1E,3R,4S,5E,10R)-1-iodo-3,10-dimethyl-9-methylidene-12-(oxan-2-yloxy)dodeca-1,5-dien-4-yl]oxymethoxy]ethyl-trimethylsilane |
| SMILES | C=C(CC/C=C/[C@H](OCOCC[Si](C)(C)C)[C@H](C)/C=C/I)[C@H](C)CCOC1CCCCO1 |
| InChI | InChI=1S/C26H47IO4Si/c1-22(23(2)15-18-30-26-13-9-10-17-29-26)11-7-8-12-25(24(3)14-16-27)31-21-28-19-20-32(4,5)6/h8,12,14,16,23-26H,1,7,9-11,13,15,17-21H2,2-6H3/b12-8+,16-14+/t23-,24-,25+,26?/m1/s1 |
| InChIKey | FZUBYROMBSNFIQ-JRZIMXTJSA-N |
| XLogP | 7.73 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.65 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|