C16H32O4Si — CID 25259704
(Z,2R,3R)-6-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)-3,4-dimethylhex-4-enal (PubChem CID 25259704) has the molecular formula C16H32O4Si and a molecular weight of 316.51 g/mol. Its IUPAC name is (Z,2R,3R)-6-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)-3,4-dimethylhex-4-enal.
| Compound Name | (Z,2R,3R)-6-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)-3,4-dimethylhex-4-enal |
|---|---|
| PubChem CID | 25259704 |
| Molecular Formula | C16H32O4Si |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | (Z,2R,3R)-6-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)-3,4-dimethylhex-4-enal |
| SMILES | COCO[C@@H](C=O)[C@H](C)/C(C)=C\CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O4Si/c1-13(14(2)15(11-17)19-12-18-6)9-10-20-21(7,8)16(3,4)5/h9,11,14-15H,10,12H2,1-8H3/b13-9-/t14-,15+/m1/s1 |
| InChIKey | HCDNASSMXSOIJG-XZVYODRBSA-N |
| XLogP | 3.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|