C31H54O4Si — CID 15726393
(12E,16E)-9-[tert-butyl(dimethyl)silyl]oxy-12,16-dimethyl-18-(oxan-2-yloxy)octadeca-12,16-dien-7-yn-6-one (PubChem CID 15726393) has the molecular formula C31H54O4Si and a molecular weight of 518.86 g/mol. Its IUPAC name is (12E,16E)-9-[tert-butyl(dimethyl)silyl]oxy-12,16-dimethyl-18-(oxan-2-yloxy)octadeca-12,16-dien-7-yn-6-one.
| Compound Name | (12E,16E)-9-[tert-butyl(dimethyl)silyl]oxy-12,16-dimethyl-18-(oxan-2-yloxy)octadeca-12,16-dien-7-yn-6-one |
|---|---|
| PubChem CID | 15726393 |
| Molecular Formula | C31H54O4Si |
| Molecular Weight | 518.86 g/mol |
| Exact Mass | 518.38 |
| IUPAC Name | (12E,16E)-9-[tert-butyl(dimethyl)silyl]oxy-12,16-dimethyl-18-(oxan-2-yloxy)octadeca-12,16-dien-7-yn-6-one |
| SMILES | CCCCCC(=O)C#CC(CC/C(C)=C/CC/C(C)=C/COC1CCCCO1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H54O4Si/c1-9-10-11-17-28(32)20-22-29(35-36(7,8)31(4,5)6)21-19-26(2)15-14-16-27(3)23-25-34-30-18-12-13-24-33-30/h15,23,29-30H,9-14,16-19,21,24-25H2,1-8H3/b26-15+,27-23+ |
| InChIKey | AAHVONZJZBPRGB-VJFFFQIWSA-N |
| XLogP | 8.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.86 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|