C43H76O4Si — CID 15726395
(2E,6E,21Z)-10-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-1-(oxan-2-yloxy)triaconta-2,6,21-trien-11-yn-13-one (PubChem CID 15726395) has the molecular formula C43H76O4Si and a molecular weight of 685.16 g/mol. Its IUPAC name is (2E,6E,21Z)-10-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-1-(oxan-2-yloxy)triaconta-2,6,21-trien-11-yn-13-one.
| Compound Name | (2E,6E,21Z)-10-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-1-(oxan-2-yloxy)triaconta-2,6,21-trien-11-yn-13-one |
|---|---|
| PubChem CID | 15726395 |
| Molecular Formula | C43H76O4Si |
| Molecular Weight | 685.16 g/mol |
| Exact Mass | 684.55 |
| IUPAC Name | (2E,6E,21Z)-10-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-1-(oxan-2-yloxy)triaconta-2,6,21-trien-11-yn-13-one |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)C#CC(CC/C(C)=C/CC/C(C)=C/COC1CCCCO1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C43H76O4Si/c1-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-29-40(44)32-34-41(47-48(7,8)43(4,5)6)33-31-38(2)27-26-28-39(3)35-37-46-42-30-24-25-36-45-42/h16-17,27,35,41-42H,9-15,18-26,28-31,33,36-37H2,1-8H3/b17-16-,38-27+,39-35+ |
| InChIKey | UEWLURHUESBWNN-NNDWWNGTSA-N |
| XLogP | 12.98 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.16 |
| LogP ≤ 5 | 12.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|