C19H32O4Si — CID 101440388
[(Z,3S)-7-methyl-8-(oxan-2-yloxy)-1-trimethylsilyloct-6-en-1-yn-3-yl] acetate (PubChem CID 101440388) has the molecular formula C19H32O4Si and a molecular weight of 352.55 g/mol. Its IUPAC name is [(Z,3S)-7-methyl-8-(oxan-2-yloxy)-1-trimethylsilyloct-6-en-1-yn-3-yl] acetate.
| Compound Name | [(Z,3S)-7-methyl-8-(oxan-2-yloxy)-1-trimethylsilyloct-6-en-1-yn-3-yl] acetate |
|---|---|
| PubChem CID | 101440388 |
| Molecular Formula | C19H32O4Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | [(Z,3S)-7-methyl-8-(oxan-2-yloxy)-1-trimethylsilyloct-6-en-1-yn-3-yl] acetate |
| SMILES | CC(=O)O[C@H](C#C[Si](C)(C)C)CC/C=C(/C)COC1CCCCO1 |
| InChI | InChI=1S/C19H32O4Si/c1-16(15-22-19-11-6-7-13-21-19)9-8-10-18(23-17(2)20)12-14-24(3,4)5/h9,18-19H,6-8,10-11,13,15H2,1-5H3/b16-9-/t18-,19?/m0/s1 |
| InChIKey | MGNFLQJMJJLIDU-WLBMJECPSA-N |
| XLogP | 4.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|