C25H44O6Si — CID 134832779
ethyl (2E,6E)-2-[2-(1,3-dioxan-2-yl)ethyl]-8-(methoxymethoxy)-6-methyl-9-(trimethylsilylmethyl)deca-2,6,9-trienoate (PubChem CID 134832779) has the molecular formula C25H44O6Si and a molecular weight of 468.71 g/mol. Its IUPAC name is ethyl (2E,6E)-2-[2-(1,3-dioxan-2-yl)ethyl]-8-(methoxymethoxy)-6-methyl-9-(trimethylsilylmethyl)deca-2,6,9-trienoate.
| Compound Name | ethyl (2E,6E)-2-[2-(1,3-dioxan-2-yl)ethyl]-8-(methoxymethoxy)-6-methyl-9-(trimethylsilylmethyl)deca-2,6,9-trienoate |
|---|---|
| PubChem CID | 134832779 |
| Molecular Formula | C25H44O6Si |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | ethyl (2E,6E)-2-[2-(1,3-dioxan-2-yl)ethyl]-8-(methoxymethoxy)-6-methyl-9-(trimethylsilylmethyl)deca-2,6,9-trienoate |
| SMILES | C=C(C[Si](C)(C)C)C(/C=C(\C)CC/C=C(\CCC1OCCCO1)C(=O)OCC)OCOC |
| InChI | InChI=1S/C25H44O6Si/c1-8-28-25(26)22(13-14-24-29-15-10-16-30-24)12-9-11-20(2)17-23(31-19-27-4)21(3)18-32(5,6)7/h12,17,23-24H,3,8-11,13-16,18-19H2,1-2,4-7H3/b20-17+,22-12+ |
| InChIKey | SIGRFHIVVPPBPA-FAORZFOBSA-N |
| XLogP | 5.63 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|