C28H48O5Si — CID 15726385
ethyl (7E,11E)-4-[tert-butyl(dimethyl)silyl]oxy-7,11-dimethyl-13-(oxan-2-yloxy)trideca-7,11-dien-2-ynoate (PubChem CID 15726385) has the molecular formula C28H48O5Si and a molecular weight of 492.77 g/mol. Its IUPAC name is ethyl (7E,11E)-4-[tert-butyl(dimethyl)silyl]oxy-7,11-dimethyl-13-(oxan-2-yloxy)trideca-7,11-dien-2-ynoate.
| Compound Name | ethyl (7E,11E)-4-[tert-butyl(dimethyl)silyl]oxy-7,11-dimethyl-13-(oxan-2-yloxy)trideca-7,11-dien-2-ynoate |
|---|---|
| PubChem CID | 15726385 |
| Molecular Formula | C28H48O5Si |
| Molecular Weight | 492.77 g/mol |
| Exact Mass | 492.33 |
| IUPAC Name | ethyl (7E,11E)-4-[tert-butyl(dimethyl)silyl]oxy-7,11-dimethyl-13-(oxan-2-yloxy)trideca-7,11-dien-2-ynoate |
| SMILES | CCOC(=O)C#CC(CC/C(C)=C/CC/C(C)=C/COC1CCCCO1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H48O5Si/c1-9-30-26(29)19-18-25(33-34(7,8)28(4,5)6)17-16-23(2)13-12-14-24(3)20-22-32-27-15-10-11-21-31-27/h13,20,25,27H,9-12,14-17,21-22H2,1-8H3/b23-13+,24-20+ |
| InChIKey | FEKNOVGSVTWLMZ-WGHMEBRLSA-N |
| XLogP | 6.94 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.77 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|