C19H32O7Si — CID 11069411
dimethyl 2-[(Z)-4-ethoxycarbonyloxybut-2-enyl]-2-[2-(trimethylsilylmethyl)prop-2-enyl]propanedioate (PubChem CID 11069411) has the molecular formula C19H32O7Si and a molecular weight of 400.54 g/mol. Its IUPAC name is dimethyl 2-[(Z)-4-ethoxycarbonyloxybut-2-enyl]-2-[2-(trimethylsilylmethyl)prop-2-enyl]propanedioate.
| Compound Name | dimethyl 2-[(Z)-4-ethoxycarbonyloxybut-2-enyl]-2-[2-(trimethylsilylmethyl)prop-2-enyl]propanedioate |
|---|---|
| PubChem CID | 11069411 |
| Molecular Formula | C19H32O7Si |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | dimethyl 2-[(Z)-4-ethoxycarbonyloxybut-2-enyl]-2-[2-(trimethylsilylmethyl)prop-2-enyl]propanedioate |
| SMILES | C=C(CC(C/C=C\COC(=O)OCC)(C(=O)OC)C(=O)OC)C[Si](C)(C)C |
| InChI | InChI=1S/C19H32O7Si/c1-8-25-18(22)26-12-10-9-11-19(16(20)23-3,17(21)24-4)13-15(2)14-27(5,6)7/h9-10H,2,8,11-14H2,1,3-7H3/b10-9- |
| InChIKey | XTPCIWFKEXCTHI-KTKRTIGZSA-N |
| XLogP | 3.72 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|