C22H40O3Si — CID 101050726
methyl 2-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-(4-methylpent-3-enyl)cyclohex-2-en-1-yl]acetate (PubChem CID 101050726) has the molecular formula C22H40O3Si and a molecular weight of 380.65 g/mol. Its IUPAC name is methyl 2-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-(4-methylpent-3-enyl)cyclohex-2-en-1-yl]acetate.
| Compound Name | methyl 2-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-(4-methylpent-3-enyl)cyclohex-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 101050726 |
| Molecular Formula | C22H40O3Si |
| Molecular Weight | 380.65 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | methyl 2-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-(4-methylpent-3-enyl)cyclohex-2-en-1-yl]acetate |
| SMILES | COC(=O)C[C@@]1(C)CC[C@H](O[Si](C)(C)C(C)(C)C)C=C1CCC=C(C)C |
| InChI | InChI=1S/C22H40O3Si/c1-17(2)11-10-12-18-15-19(25-26(8,9)21(3,4)5)13-14-22(18,6)16-20(23)24-7/h11,15,19H,10,12-14,16H2,1-9H3/t19-,22+/m0/s1 |
| InChIKey | UAYQNSUBQLUAFA-SIKLNZKXSA-N |
| XLogP | 6.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.65 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|