C22H40O3Si — CID 134835024
ethyl (1R)-1-but-3-enyl-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohex-2-ene-1-carboxylate (PubChem CID 134835024) has the molecular formula C22H40O3Si and a molecular weight of 380.65 g/mol. Its IUPAC name is ethyl (1R)-1-but-3-enyl-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohex-2-ene-1-carboxylate.
| Compound Name | ethyl (1R)-1-but-3-enyl-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 134835024 |
| Molecular Formula | C22H40O3Si |
| Molecular Weight | 380.65 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | ethyl (1R)-1-but-3-enyl-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohex-2-ene-1-carboxylate |
| SMILES | C=CCC[C@]1(C(=O)OCC)C(C)=CC(O[Si](C)(C)C(C)(C)C)CC1(C)C |
| InChI | InChI=1S/C22H40O3Si/c1-11-13-14-22(19(23)24-12-2)17(3)15-18(16-21(22,7)8)25-26(9,10)20(4,5)6/h11,15,18H,1,12-14,16H2,2-10H3/t18?,22-/m1/s1 |
| InChIKey | PSWGSXYUXRNAOE-LMNIDFBRSA-N |
| XLogP | 6.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.65 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|