C17H28O3 — CID 135050595
ethyl (1S,6S)-4-methoxy-2,6-dimethyl-1-pent-4-enylcyclohex-2-ene-1-carboxylate (PubChem CID 135050595) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is ethyl (1S,6S)-4-methoxy-2,6-dimethyl-1-pent-4-enylcyclohex-2-ene-1-carboxylate.
| Compound Name | ethyl (1S,6S)-4-methoxy-2,6-dimethyl-1-pent-4-enylcyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 135050595 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | ethyl (1S,6S)-4-methoxy-2,6-dimethyl-1-pent-4-enylcyclohex-2-ene-1-carboxylate |
| SMILES | C=CCCC[C@@]1(C(=O)OCC)C(C)=CC(OC)C[C@@H]1C |
| InChI | InChI=1S/C17H28O3/c1-6-8-9-10-17(16(18)20-7-2)13(3)11-15(19-5)12-14(17)4/h6,11,14-15H,1,7-10,12H2,2-5H3/t14-,15?,17+/m0/s1 |
| InChIKey | POVPZMMBUOZUTN-XJIUDMAQSA-N |
| XLogP | 3.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|