C17H24O4 — CID 132566255
(4S,5S,7Z,10S)-4-ethoxy-5,9,9-trimethyl-11-oxabicyclo[8.2.1]trideca-1(13),7-diene-6,12-dione (PubChem CID 132566255) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is (4S,5S,7Z,10S)-4-ethoxy-5,9,9-trimethyl-11-oxabicyclo[8.2.1]trideca-1(13),7-diene-6,12-dione.
| Compound Name | (4S,5S,7Z,10S)-4-ethoxy-5,9,9-trimethyl-11-oxabicyclo[8.2.1]trideca-1(13),7-diene-6,12-dione |
|---|---|
| PubChem CID | 132566255 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (4S,5S,7Z,10S)-4-ethoxy-5,9,9-trimethyl-11-oxabicyclo[8.2.1]trideca-1(13),7-diene-6,12-dione |
| SMILES | CCO[C@H]1CCC2=C[C@H](OC2=O)C(C)(C)/C=C\C(=O)[C@H]1C |
| InChI | InChI=1S/C17H24O4/c1-5-20-14-7-6-12-10-15(21-16(12)19)17(3,4)9-8-13(18)11(14)2/h8-11,14-15H,5-7H2,1-4H3/b9-8-/t11-,14+,15+/m1/s1 |
| InChIKey | UUWXRKXSWZFMIO-VSTHLSDOSA-N |
| XLogP | 2.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |