C19H36O2Si — CID 134870496
4-[(4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohex-2-en-1-yl]butan-2-one (PubChem CID 134870496) has the molecular formula C19H36O2Si and a molecular weight of 324.58 g/mol. Its IUPAC name is 4-[(4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohex-2-en-1-yl]butan-2-one.
| Compound Name | 4-[(4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohex-2-en-1-yl]butan-2-one |
|---|---|
| PubChem CID | 134870496 |
| Molecular Formula | C19H36O2Si |
| Molecular Weight | 324.58 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | 4-[(4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohex-2-en-1-yl]butan-2-one |
| SMILES | CC(=O)CCC1C(C)=C[C@@H](O[Si](C)(C)C(C)(C)C)CC1(C)C |
| InChI | InChI=1S/C19H36O2Si/c1-14-12-16(21-22(8,9)18(3,4)5)13-19(6,7)17(14)11-10-15(2)20/h12,16-17H,10-11,13H2,1-9H3/t16-,17?/m1/s1 |
| InChIKey | MRYUHXOKLGZTNI-TZHYSIJRSA-N |
| XLogP | 5.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.58 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|