C27H46O2Si — CID 11697685
(1R,3E,7E,11R)-4,8-dimethyl-13-tri(propan-2-yl)silyloxybicyclo[9.4.0]pentadeca-3,7,12-triene-1-carbaldehyde (PubChem CID 11697685) has the molecular formula C27H46O2Si and a molecular weight of 430.75 g/mol. Its IUPAC name is (1R,3E,7E,11R)-4,8-dimethyl-13-tri(propan-2-yl)silyloxybicyclo[9.4.0]pentadeca-3,7,12-triene-1-carbaldehyde.
| Compound Name | (1R,3E,7E,11R)-4,8-dimethyl-13-tri(propan-2-yl)silyloxybicyclo[9.4.0]pentadeca-3,7,12-triene-1-carbaldehyde |
|---|---|
| PubChem CID | 11697685 |
| Molecular Formula | C27H46O2Si |
| Molecular Weight | 430.75 g/mol |
| Exact Mass | 430.33 |
| IUPAC Name | (1R,3E,7E,11R)-4,8-dimethyl-13-tri(propan-2-yl)silyloxybicyclo[9.4.0]pentadeca-3,7,12-triene-1-carbaldehyde |
| SMILES | C/C1=C\C[C@]2(C=O)CCC(O[Si](C(C)C)(C(C)C)C(C)C)=C[C@H]2CC/C(C)=C/CC1 |
| InChI | InChI=1S/C27H46O2Si/c1-20(2)30(21(3)4,22(5)6)29-26-15-17-27(19-28)16-14-24(8)11-9-10-23(7)12-13-25(27)18-26/h10,14,18-22,25H,9,11-13,15-17H2,1-8H3/b23-10+,24-14+/t25-,27-/m1/s1 |
| InChIKey | YNLONMFIYXLOKU-SIKZBOCNSA-N |
| XLogP | 8.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.75 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|