C24H42O2Si — CID 166446008
(7R,7aR)-3a-but-3-enyl-4,7-dimethyl-5-tri(propan-2-yl)silyloxy-3,4,7,7a-tetrahydro-2H-inden-1-one (PubChem CID 166446008) has the molecular formula C24H42O2Si and a molecular weight of 390.68 g/mol. Its IUPAC name is (7R,7aR)-3a-but-3-enyl-4,7-dimethyl-5-tri(propan-2-yl)silyloxy-3,4,7,7a-tetrahydro-2H-inden-1-one.
| Compound Name | (7R,7aR)-3a-but-3-enyl-4,7-dimethyl-5-tri(propan-2-yl)silyloxy-3,4,7,7a-tetrahydro-2H-inden-1-one |
|---|---|
| PubChem CID | 166446008 |
| Molecular Formula | C24H42O2Si |
| Molecular Weight | 390.68 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | (7R,7aR)-3a-but-3-enyl-4,7-dimethyl-5-tri(propan-2-yl)silyloxy-3,4,7,7a-tetrahydro-2H-inden-1-one |
| SMILES | C=CCCC12CCC(=O)[C@@H]1[C@H](C)C=C(O[Si](C(C)C)(C(C)C)C(C)C)C2C |
| InChI | InChI=1S/C24H42O2Si/c1-10-11-13-24-14-12-21(25)23(24)19(8)15-22(20(24)9)26-27(16(2)3,17(4)5)18(6)7/h10,15-20,23H,1,11-14H2,2-9H3/t19-,20?,23+,24?/m1/s1 |
| InChIKey | QZJOUWPMGJHLHK-BPOHWNNBSA-N |
| XLogP | 7.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.68 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|