C21H38O2Si — CID 162786797
(3aR,7aS)-7a-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3,3,6-trimethyl-3a,4,6,7-tetrahydroinden-5-one (PubChem CID 162786797) has the molecular formula C21H38O2Si and a molecular weight of 350.62 g/mol. Its IUPAC name is (3aR,7aS)-7a-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3,3,6-trimethyl-3a,4,6,7-tetrahydroinden-5-one.
| Compound Name | (3aR,7aS)-7a-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3,3,6-trimethyl-3a,4,6,7-tetrahydroinden-5-one |
|---|---|
| PubChem CID | 162786797 |
| Molecular Formula | C21H38O2Si |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | (3aR,7aS)-7a-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3,3,6-trimethyl-3a,4,6,7-tetrahydroinden-5-one |
| SMILES | CC1C[C@@]2(CCCO[Si](C)(C)C(C)(C)C)C=CC(C)(C)[C@H]2CC1=O |
| InChI | InChI=1S/C21H38O2Si/c1-16-15-21(10-9-13-23-24(7,8)19(2,3)4)12-11-20(5,6)18(21)14-17(16)22/h11-12,16,18H,9-10,13-15H2,1-8H3/t16?,18-,21-/m1/s1 |
| InChIKey | UWRSLNQWUKXFOU-QHNQYTFYSA-N |
| XLogP | 5.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|