C23H40O2Si — CID 134945476
(3aS,6S,7aS)-3a-methyl-6-prop-1-en-2-yl-7a-[tri(propan-2-yl)silyloxymethyl]-3,5,6,7-tetrahydroinden-4-one (PubChem CID 134945476) has the molecular formula C23H40O2Si and a molecular weight of 376.66 g/mol. Its IUPAC name is (3aS,6S,7aS)-3a-methyl-6-prop-1-en-2-yl-7a-[tri(propan-2-yl)silyloxymethyl]-3,5,6,7-tetrahydroinden-4-one.
| Compound Name | (3aS,6S,7aS)-3a-methyl-6-prop-1-en-2-yl-7a-[tri(propan-2-yl)silyloxymethyl]-3,5,6,7-tetrahydroinden-4-one |
|---|---|
| PubChem CID | 134945476 |
| Molecular Formula | C23H40O2Si |
| Molecular Weight | 376.66 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | (3aS,6S,7aS)-3a-methyl-6-prop-1-en-2-yl-7a-[tri(propan-2-yl)silyloxymethyl]-3,5,6,7-tetrahydroinden-4-one |
| SMILES | C=C(C)[C@@H]1CC(=O)[C@@]2(C)CC=C[C@@]2(CO[Si](C(C)C)(C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C23H40O2Si/c1-16(2)20-13-21(24)22(9)11-10-12-23(22,14-20)15-25-26(17(3)4,18(5)6)19(7)8/h10,12,17-20H,1,11,13-15H2,2-9H3/t20-,22-,23+/m1/s1 |
| InChIKey | QCWVTETZKMUJQI-MZYLBHOOSA-N |
| XLogP | 6.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.66 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|