C21H36O2Si — CID 78148806
11-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4,4-trimethyltricyclo[5.2.2.02,6]undec-10-en-8-one (PubChem CID 78148806) has the molecular formula C21H36O2Si and a molecular weight of 348.60 g/mol. Its IUPAC name is 11-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4,4-trimethyltricyclo[5.2.2.02,6]undec-10-en-8-one.
| Compound Name | 11-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4,4-trimethyltricyclo[5.2.2.02,6]undec-10-en-8-one |
|---|---|
| PubChem CID | 78148806 |
| Molecular Formula | C21H36O2Si |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | 11-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4,4-trimethyltricyclo[5.2.2.02,6]undec-10-en-8-one |
| SMILES | CC1(C)CC2C3C(=O)CC(C)(C=C3CO[Si](C)(C)C(C)(C)C)C2C1 |
| InChI | InChI=1S/C21H36O2Si/c1-19(2,3)24(7,8)23-13-14-9-21(6)12-17(22)18(14)15-10-20(4,5)11-16(15)21/h9,15-16,18H,10-13H2,1-8H3 |
| InChIKey | SSEDLKQEEVRNIT-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|