C24H40O3Si — CID 137303043
CID 137303043 (PubChem CID 137303043) has the molecular formula C24H40O3Si and a molecular weight of 404.67 g/mol.
| Compound Name | CID 137303043 |
|---|---|
| PubChem CID | 137303043 |
| Molecular Formula | C24H40O3Si |
| Molecular Weight | 404.67 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | — |
| SMILES | [CH2]O[C@H](C[C@@](C)(C=C)/C(=C/C)O[Si](C)(C)C)C1(C)C(C)CC[C]2CCC(=O)[C@@H]21 |
| InChI | InChI=1S/C24H40O3Si/c1-10-20(27-28(7,8)9)23(4,11-2)16-21(26-6)24(5)17(3)12-13-18-14-15-19(25)22(18)24/h10-11,17,21-22H,2,6,12-16H2,1,3-5,7-9H3/b20-10-/t17?,21-,22-,23-,24?/m1/s1 |
| InChIKey | SYOHRXWQSFHJSE-XCQNMGBXSA-N |
| XLogP | 6.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.67 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|