C24H40O3Si — CID 134844249
(6R)-7-[(E,1R,3S)-3-ethenyl-1-methoxy-3-methyl-4-trimethylsilyloxyhex-4-enyl]-6,7-dimethyl-3,4,5,6-tetrahydro-2H-inden-1-one (PubChem CID 134844249) has the molecular formula C24H40O3Si and a molecular weight of 404.67 g/mol. Its IUPAC name is (6R)-7-[(E,1R,3S)-3-ethenyl-1-methoxy-3-methyl-4-trimethylsilyloxyhex-4-enyl]-6,7-dimethyl-3,4,5,6-tetrahydro-2H-inden-1-one.
| Compound Name | (6R)-7-[(E,1R,3S)-3-ethenyl-1-methoxy-3-methyl-4-trimethylsilyloxyhex-4-enyl]-6,7-dimethyl-3,4,5,6-tetrahydro-2H-inden-1-one |
|---|---|
| PubChem CID | 134844249 |
| Molecular Formula | C24H40O3Si |
| Molecular Weight | 404.67 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | (6R)-7-[(E,1R,3S)-3-ethenyl-1-methoxy-3-methyl-4-trimethylsilyloxyhex-4-enyl]-6,7-dimethyl-3,4,5,6-tetrahydro-2H-inden-1-one |
| SMILES | C=C[C@](C)(C[C@@H](OC)C1(C)C2=C(CCC2=O)CC[C@H]1C)/C(=C\C)O[Si](C)(C)C |
| InChI | InChI=1S/C24H40O3Si/c1-10-20(27-28(7,8)9)23(4,11-2)16-21(26-6)24(5)17(3)12-13-18-14-15-19(25)22(18)24/h10-11,17,21H,2,12-16H2,1,3-9H3/b20-10+/t17-,21-,23-,24?/m1/s1 |
| InChIKey | OIMSQVNVDBPSGQ-XRDBGRSYSA-N |
| XLogP | 6.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.67 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|