C19H32O2Si — CID 53310488
(2S,3aS,7aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-ethenyl-6-methyl-2,3,4,7a-tetrahydro-1H-inden-5-one (PubChem CID 53310488) has the molecular formula C19H32O2Si and a molecular weight of 320.55 g/mol. Its IUPAC name is (2S,3aS,7aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-ethenyl-6-methyl-2,3,4,7a-tetrahydro-1H-inden-5-one.
| Compound Name | (2S,3aS,7aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-ethenyl-6-methyl-2,3,4,7a-tetrahydro-1H-inden-5-one |
|---|---|
| PubChem CID | 53310488 |
| Molecular Formula | C19H32O2Si |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | (2S,3aS,7aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-ethenyl-6-methyl-2,3,4,7a-tetrahydro-1H-inden-5-one |
| SMILES | C=C[C@H]1C[C@H]2C=C(C)C(=O)C[C@@]2(CO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C19H32O2Si/c1-8-15-10-16-9-14(2)17(20)12-19(16,11-15)13-21-22(6,7)18(3,4)5/h8-9,15-16H,1,10-13H2,2-7H3/t15-,16+,19+/m0/s1 |
| InChIKey | KTZSKBVPTSCGTI-FRQCXROJSA-N |
| XLogP | 5.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|