C24H42O3Si — CID 57413056
(2R)-2-[2-[(1S,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-oxo-3-propan-2-ylcyclopentyl]ethyl]-2-methylcyclohex-3-en-1-one (PubChem CID 57413056) has the molecular formula C24H42O3Si and a molecular weight of 406.68 g/mol. Its IUPAC name is (2R)-2-[2-[(1S,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-oxo-3-propan-2-ylcyclopentyl]ethyl]-2-methylcyclohex-3-en-1-one.
| Compound Name | (2R)-2-[2-[(1S,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-oxo-3-propan-2-ylcyclopentyl]ethyl]-2-methylcyclohex-3-en-1-one |
|---|---|
| PubChem CID | 57413056 |
| Molecular Formula | C24H42O3Si |
| Molecular Weight | 406.68 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | (2R)-2-[2-[(1S,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-oxo-3-propan-2-ylcyclopentyl]ethyl]-2-methylcyclohex-3-en-1-one |
| SMILES | CC(C)[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@](C)(CC[C@]2(C)C=CCCC2=O)C1=O |
| InChI | InChI=1S/C24H42O3Si/c1-17(2)18-16-20(27-28(8,9)22(3,4)5)24(7,21(18)26)15-14-23(6)13-11-10-12-19(23)25/h11,13,17-18,20H,10,12,14-16H2,1-9H3/t18-,20-,23+,24+/m1/s1 |
| InChIKey | QQKRJJHSFZXXJQ-YKBLPDKLSA-N |
| XLogP | 6.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.68 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|