C15H26O2Si — CID 134980131
(3S,3aS,7aR)-3-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,4,7,7a-hexahydroinden-1-one (PubChem CID 134980131) has the molecular formula C15H26O2Si and a molecular weight of 266.46 g/mol. Its IUPAC name is (3S,3aS,7aR)-3-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,4,7,7a-hexahydroinden-1-one.
| Compound Name | (3S,3aS,7aR)-3-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,4,7,7a-hexahydroinden-1-one |
|---|---|
| PubChem CID | 134980131 |
| Molecular Formula | C15H26O2Si |
| Molecular Weight | 266.46 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | (3S,3aS,7aR)-3-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,4,7,7a-hexahydroinden-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC(=O)[C@@H]2CC=CC[C@H]12 |
| InChI | InChI=1S/C15H26O2Si/c1-15(2,3)18(4,5)17-14-10-13(16)11-8-6-7-9-12(11)14/h6-7,11-12,14H,8-10H2,1-5H3/t11-,12+,14+/m1/s1 |
| InChIKey | BATFCTGBERYBDK-DYEKYZERSA-N |
| XLogP | 3.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|