C20H30O3Si — CID 135010498
(3aS,5aS,7R,8S,8aS,8bS)-8-[tert-butyl(dimethyl)silyl]oxy-4,7-dimethyl-3a,5a,7,8,8a,8b-hexahydro-as-indacene-1,6-dione (PubChem CID 135010498) has the molecular formula C20H30O3Si and a molecular weight of 346.54 g/mol. Its IUPAC name is (3aS,5aS,7R,8S,8aS,8bS)-8-[tert-butyl(dimethyl)silyl]oxy-4,7-dimethyl-3a,5a,7,8,8a,8b-hexahydro-as-indacene-1,6-dione.
| Compound Name | (3aS,5aS,7R,8S,8aS,8bS)-8-[tert-butyl(dimethyl)silyl]oxy-4,7-dimethyl-3a,5a,7,8,8a,8b-hexahydro-as-indacene-1,6-dione |
|---|---|
| PubChem CID | 135010498 |
| Molecular Formula | C20H30O3Si |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (3aS,5aS,7R,8S,8aS,8bS)-8-[tert-butyl(dimethyl)silyl]oxy-4,7-dimethyl-3a,5a,7,8,8a,8b-hexahydro-as-indacene-1,6-dione |
| SMILES | CC1=C[C@@H]2C(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2[C@H]2C(=O)C=C[C@H]12 |
| InChI | InChI=1S/C20H30O3Si/c1-11-10-14-17(16-13(11)8-9-15(16)21)19(12(2)18(14)22)23-24(6,7)20(3,4)5/h8-10,12-14,16-17,19H,1-7H3/t12-,13+,14-,16+,17-,19+/m0/s1 |
| InChIKey | LVCBYAATJMKMST-XKYOCXKOSA-N |
| XLogP | 4.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|