C16H26O2Si — CID 11119432
(1S,2R,5S,6S,7R)-5-[tert-butyl(dimethyl)silyl]oxytricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 11119432) has the molecular formula C16H26O2Si and a molecular weight of 278.47 g/mol. Its IUPAC name is (1S,2R,5S,6S,7R)-5-[tert-butyl(dimethyl)silyl]oxytricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1S,2R,5S,6S,7R)-5-[tert-butyl(dimethyl)silyl]oxytricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 11119432 |
| Molecular Formula | C16H26O2Si |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | (1S,2R,5S,6S,7R)-5-[tert-butyl(dimethyl)silyl]oxytricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC(=O)[C@H]2[C@@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C16H26O2Si/c1-16(2,3)19(4,5)18-13-9-12(17)14-10-6-7-11(8-10)15(13)14/h6-7,10-11,13-15H,8-9H2,1-5H3/t10-,11+,13+,14+,15-/m1/s1 |
| InChIKey | JXGKIMYPVJJAGR-VJFWYMLFSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|