C17H26O2Si — CID 138976285
(1R,7S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]tricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 138976285) has the molecular formula C17H26O2Si and a molecular weight of 290.48 g/mol. Its IUPAC name is (1R,7S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]tricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | (1R,7S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]tricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 138976285 |
| Molecular Formula | C17H26O2Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | (1R,7S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]tricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=CC2C(C1=O)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C17H26O2Si/c1-17(2,3)20(4,5)19-10-13-9-14-11-6-7-12(8-11)15(14)16(13)18/h6-7,9,11-12,14-15H,8,10H2,1-5H3/t11-,12+,14?,15?/m1/s1 |
| InChIKey | BAYJTQKXSMGAED-RMNLLRHXSA-N |
| XLogP | 3.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|