C23H36O2Si — CID 10643055
(1S,6Z,7R,9Z,11S,14S)-14-[tert-butyl(dimethyl)silyl]oxy-6-ethylidene-10-methyltricyclo[9.3.0.03,7]tetradeca-3,9-dien-5-one (PubChem CID 10643055) has the molecular formula C23H36O2Si and a molecular weight of 372.63 g/mol. Its IUPAC name is (1S,6Z,7R,9Z,11S,14S)-14-[tert-butyl(dimethyl)silyl]oxy-6-ethylidene-10-methyltricyclo[9.3.0.03,7]tetradeca-3,9-dien-5-one.
| Compound Name | (1S,6Z,7R,9Z,11S,14S)-14-[tert-butyl(dimethyl)silyl]oxy-6-ethylidene-10-methyltricyclo[9.3.0.03,7]tetradeca-3,9-dien-5-one |
|---|---|
| PubChem CID | 10643055 |
| Molecular Formula | C23H36O2Si |
| Molecular Weight | 372.63 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | (1S,6Z,7R,9Z,11S,14S)-14-[tert-butyl(dimethyl)silyl]oxy-6-ethylidene-10-methyltricyclo[9.3.0.03,7]tetradeca-3,9-dien-5-one |
| SMILES | C/C=C1\C(=O)C=C2C[C@@H]3[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]3/C(C)=C\C[C@H]21 |
| InChI | InChI=1S/C23H36O2Si/c1-8-17-19-10-9-15(2)18-11-12-22(25-26(6,7)23(3,4)5)20(18)13-16(19)14-21(17)24/h8-9,14,18-20,22H,10-13H2,1-7H3/b15-9-,17-8-/t18-,19-,20+,22+/m1/s1 |
| InChIKey | KBCPQWJFCKGRMQ-PPWSCTKVSA-N |
| XLogP | 6.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.63 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|